C29H29NO7S — CID 3111047
[3-ethoxy-3-oxo-2-[(9-oxofluoren-2-yl)sulfonylamino]-1-phenylpropyl] pentanoate (PubChem CID 3111047) has the molecular formula C29H29NO7S and a molecular weight of 535.62 g/mol. Its IUPAC name is [3-ethoxy-3-oxo-2-[(9-oxofluoren-2-yl)sulfonylamino]-1-phenylpropyl] pentanoate.
| Compound Name | [3-ethoxy-3-oxo-2-[(9-oxofluoren-2-yl)sulfonylamino]-1-phenylpropyl] pentanoate |
|---|---|
| PubChem CID | 3111047 |
| Molecular Formula | C29H29NO7S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | [3-ethoxy-3-oxo-2-[(9-oxofluoren-2-yl)sulfonylamino]-1-phenylpropyl] pentanoate |
| SMILES | CCCCC(=O)OC(c1ccccc1)C(NS(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1-2)C(=O)OCC |
| InChI | InChI=1S/C29H29NO7S/c1-3-5-15-25(31)37-28(19-11-7-6-8-12-19)26(29(33)36-4-2)30-38(34,35)20-16-17-22-21-13-9-10-14-23(21)27(32)24(22)18-20/h6-14,16-18,26,28,30H,3-5,15H2,1-2H3 |
| InChIKey | JTEGXJBLZMCLNR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |