C17H13ClN2OSe — CID 3126150
1-[5-[(4-chlorophenyl)methylidene]-4-phenyl-1,3,4-selenadiazol-2-yl]ethanone (PubChem CID 3126150) has the molecular formula C17H13ClN2OSe and a molecular weight of 375.72 g/mol. Its IUPAC name is 1-[5-[(4-chlorophenyl)methylidene]-4-phenyl-1,3,4-selenadiazol-2-yl]ethanone.
| Compound Name | 1-[5-[(4-chlorophenyl)methylidene]-4-phenyl-1,3,4-selenadiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 3126150 |
| Molecular Formula | C17H13ClN2OSe |
| Molecular Weight | 375.72 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 1-[5-[(4-chlorophenyl)methylidene]-4-phenyl-1,3,4-selenadiazol-2-yl]ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)C(=Cc2ccc(Cl)cc2)[Se]1 |
| InChI | InChI=1S/C17H13ClN2OSe/c1-12(21)17-19-20(15-5-3-2-4-6-15)16(22-17)11-13-7-9-14(18)10-8-13/h2-11H,1H3 |
| InChIKey | PSACAFTYJBCKDD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|