C17H14N2OS — CID 11822513
1-[(5E)-5-benzylidene-4-phenyl-1,3,4-thiadiazol-2-yl]ethanone (PubChem CID 11822513) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-[(5E)-5-benzylidene-4-phenyl-1,3,4-thiadiazol-2-yl]ethanone.
| Compound Name | 1-[(5E)-5-benzylidene-4-phenyl-1,3,4-thiadiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 11822513 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-[(5E)-5-benzylidene-4-phenyl-1,3,4-thiadiazol-2-yl]ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)/C(=C\c2ccccc2)S1 |
| InChI | InChI=1S/C17H14N2OS/c1-13(20)17-18-19(15-10-6-3-7-11-15)16(21-17)12-14-8-4-2-5-9-14/h2-12H,1H3/b16-12+ |
| InChIKey | ADFIXTXQLTUUQY-FOWTUZBSSA-N |
| XLogP | 4.14 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_urea_ene(1)', 'substructure': 'N/A'} |
|---|