C21H19F3N4O3 — CID 31479716
2-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-5-phenyl-1,3-oxazole (PubChem CID 31479716) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is 2-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-5-phenyl-1,3-oxazole.
| Compound Name | 2-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-5-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 31479716 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-5-phenyl-1,3-oxazole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCN(Cc2ncc(-c3ccccc3)o2)CC1 |
| InChI | InChI=1S/C21H19F3N4O3/c22-21(23,24)16-6-7-17(18(12-16)28(29)30)27-10-8-26(9-11-27)14-20-25-13-19(31-20)15-4-2-1-3-5-15/h1-7,12-13H,8-11,14H2 |
| InChIKey | PXZNQZGHBDXNIH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|