C28H27F3N6O2S — CID 3984404
1-[2-[(4-benzyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine (PubChem CID 3984404) has the molecular formula C28H27F3N6O2S and a molecular weight of 568.63 g/mol. Its IUPAC name is 1-[2-[(4-benzyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[2-[(4-benzyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 3984404 |
| Molecular Formula | C28H27F3N6O2S |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 1-[2-[(4-benzyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCN(CCSc2nnc(-c3ccccc3)n2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H27F3N6O2S/c29-28(30,31)23-11-12-24(25(19-23)37(38)39)35-15-13-34(14-16-35)17-18-40-27-33-32-26(22-9-5-2-6-10-22)36(27)20-21-7-3-1-4-8-21/h1-12,19H,13-18,20H2 |
| InChIKey | VDHIRWIAHYSGJU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|