C23H22F3N5O4 — CID 39715456
1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-1-one (PubChem CID 39715456) has the molecular formula C23H22F3N5O4 and a molecular weight of 489.45 g/mol. Its IUPAC name is 1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-1-one.
| Compound Name | 1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 39715456 |
| Molecular Formula | C23H22F3N5O4 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 1-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-1-one |
| SMILES | O=C(CCCc1nnc(-c2ccccc2)o1)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H22F3N5O4/c24-23(25,26)17-9-10-18(19(15-17)31(33)34)29-11-13-30(14-12-29)21(32)8-4-7-20-27-28-22(35-20)16-5-2-1-3-6-16/h1-3,5-6,9-10,15H,4,7-8,11-14H2 |
| InChIKey | QJFVGSYIIUSZIB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 105.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|