C21H18F3N5O5 — CID 46665106
3-[2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-oxoethyl]-5-phenyl-1,3,4-oxadiazol-2-one (PubChem CID 46665106) has the molecular formula C21H18F3N5O5 and a molecular weight of 477.40 g/mol. Its IUPAC name is 3-[2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-oxoethyl]-5-phenyl-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-oxoethyl]-5-phenyl-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 46665106 |
| Molecular Formula | C21H18F3N5O5 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 3-[2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-2-oxoethyl]-5-phenyl-1,3,4-oxadiazol-2-one |
| SMILES | O=C(Cn1nc(-c2ccccc2)oc1=O)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H18F3N5O5/c22-21(23,24)15-6-7-16(17(12-15)29(32)33)26-8-10-27(11-9-26)18(30)13-28-20(31)34-19(25-28)14-4-2-1-3-5-14/h1-7,12H,8-11,13H2 |
| InChIKey | YAWWYLGTCGNIIY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 114.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|