C27H26ClN3O5 — CID 3154042
2-chloro-N-(2,6-dimethylphenyl)-N-[2-morpholin-4-yl-2-(4-nitrophenyl)acetyl]benzamide (PubChem CID 3154042) has the molecular formula C27H26ClN3O5 and a molecular weight of 507.97 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dimethylphenyl)-N-[2-morpholin-4-yl-2-(4-nitrophenyl)acetyl]benzamide.
| Compound Name | 2-chloro-N-(2,6-dimethylphenyl)-N-[2-morpholin-4-yl-2-(4-nitrophenyl)acetyl]benzamide |
|---|---|
| PubChem CID | 3154042 |
| Molecular Formula | C27H26ClN3O5 |
| Molecular Weight | 507.97 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 2-chloro-N-(2,6-dimethylphenyl)-N-[2-morpholin-4-yl-2-(4-nitrophenyl)acetyl]benzamide |
| SMILES | Cc1cccc(C)c1N(C(=O)c1ccccc1Cl)C(=O)C(c1ccc([N+](=O)[O-])cc1)N1CCOCC1 |
| InChI | InChI=1S/C27H26ClN3O5/c1-18-6-5-7-19(2)24(18)30(26(32)22-8-3-4-9-23(22)28)27(33)25(29-14-16-36-17-15-29)20-10-12-21(13-11-20)31(34)35/h3-13,25H,14-17H2,1-2H3 |
| InChIKey | LRWQOJYFZBJAOO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.97 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|