C12H18ClN5OS — CID 31688574
2-[4-[(5-chlorothiadiazol-4-yl)methyl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 31688574) has the molecular formula C12H18ClN5OS and a molecular weight of 315.83 g/mol. Its IUPAC name is 2-[4-[(5-chlorothiadiazol-4-yl)methyl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[(5-chlorothiadiazol-4-yl)methyl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 31688574 |
| Molecular Formula | C12H18ClN5OS |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[4-[(5-chlorothiadiazol-4-yl)methyl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(Cc2nnsc2Cl)CC1 |
| InChI | InChI=1S/C12H18ClN5OS/c1-2-3-14-11(19)9-18-6-4-17(5-7-18)8-10-12(13)20-16-15-10/h2H,1,3-9H2,(H,14,19) |
| InChIKey | ATOAWVJZJIBQTM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|