C18H12FNO4S2 — CID 31712486
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 5-(4-fluorophenyl)thiophene-2-carboxylate (PubChem CID 31712486) has the molecular formula C18H12FNO4S2 and a molecular weight of 389.43 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 5-(4-fluorophenyl)thiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 5-(4-fluorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 31712486 |
| Molecular Formula | C18H12FNO4S2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 5-(4-fluorophenyl)thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccc(F)cc2)s1)NC(=O)c1cccs1 |
| InChI | InChI=1S/C18H12FNO4S2/c19-12-5-3-11(4-6-12)13-7-8-15(26-13)18(23)24-10-16(21)20-17(22)14-2-1-9-25-14/h1-9H,10H2,(H,20,21,22) |
| InChIKey | BDGRCYBHUUZRCH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |