C23H21FN2O4S — CID 30968052
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 5-(4-fluorophenyl)thiophene-2-carboxylate (PubChem CID 30968052) has the molecular formula C23H21FN2O4S and a molecular weight of 440.50 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 5-(4-fluorophenyl)thiophene-2-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 5-(4-fluorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 30968052 |
| Molecular Formula | C23H21FN2O4S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 5-(4-fluorophenyl)thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccc(F)cc2)s1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H21FN2O4S/c24-17-3-1-16(2-4-17)20-9-10-21(31-20)23(28)30-15-22(27)25-18-5-7-19(8-6-18)26-11-13-29-14-12-26/h1-10H,11-15H2,(H,25,27) |
| InChIKey | ZOLLJFIXBYFBQV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|