C17H16N4O5 — CID 31882487
[(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 1-methyl-4-nitropyrrole-2-carboxylate (PubChem CID 31882487) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is [(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 1-methyl-4-nitropyrrole-2-carboxylate.
| Compound Name | [(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 31882487 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 1-methyl-4-nitropyrrole-2-carboxylate |
| SMILES | Cc1ccc(-c2nnc([C@@H](C)OC(=O)c3cc([N+](=O)[O-])cn3C)o2)cc1 |
| InChI | InChI=1S/C17H16N4O5/c1-10-4-6-12(7-5-10)16-19-18-15(26-16)11(2)25-17(22)14-8-13(21(23)24)9-20(14)3/h4-9,11H,1-3H3/t11-/m1/s1 |
| InChIKey | SXRDVLBCSJCTDX-LLVKDONJSA-N |
| XLogP | 3.21 |
| TPSA | 113.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|