C13H13N7O2 — CID 3246450
4-[(2,6-diamino-7H-purin-8-yl)methylamino]benzoic acid (PubChem CID 3246450) has the molecular formula C13H13N7O2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 4-[(2,6-diamino-7H-purin-8-yl)methylamino]benzoic acid.
| Compound Name | 4-[(2,6-diamino-7H-purin-8-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 3246450 |
| Molecular Formula | C13H13N7O2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-[(2,6-diamino-7H-purin-8-yl)methylamino]benzoic acid |
| SMILES | Nc1nc(N)c2[nH]c(CNc3ccc(C(=O)O)cc3)nc2n1 |
| InChI | InChI=1S/C13H13N7O2/c14-10-9-11(20-13(15)19-10)18-8(17-9)5-16-7-3-1-6(2-4-7)12(21)22/h1-4,16H,5H2,(H,21,22)(H5,14,15,17,18,19,20) |
| InChIKey | WEAIDDOLGAIXED-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 155.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |