C23H23N3O3S2 — CID 32561578
N-(2-cyclopentylsulfanylphenyl)-4-(pyridin-4-ylsulfamoyl)benzamide (PubChem CID 32561578) has the molecular formula C23H23N3O3S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylphenyl)-4-(pyridin-4-ylsulfamoyl)benzamide.
| Compound Name | N-(2-cyclopentylsulfanylphenyl)-4-(pyridin-4-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 32561578 |
| Molecular Formula | C23H23N3O3S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-(2-cyclopentylsulfanylphenyl)-4-(pyridin-4-ylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccccc1SC1CCCC1)c1ccc(S(=O)(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C23H23N3O3S2/c27-23(25-21-7-3-4-8-22(21)30-19-5-1-2-6-19)17-9-11-20(12-10-17)31(28,29)26-18-13-15-24-16-14-18/h3-4,7-16,19H,1-2,5-6H2,(H,24,26)(H,25,27) |
| InChIKey | XJYQAQDFEDVLLZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |