C16H16FN2O2+ — CID 3279580
2-(4-fluorophenyl)-3-(furan-2-yl)-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one (PubChem CID 3279580) has the molecular formula C16H16FN2O2+ and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(furan-2-yl)-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one.
| Compound Name | 2-(4-fluorophenyl)-3-(furan-2-yl)-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one |
|---|---|
| PubChem CID | 3279580 |
| Molecular Formula | C16H16FN2O2+ |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(furan-2-yl)-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one |
| SMILES | O=C1C2CCC[NH+]2C(c2ccco2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2O2/c17-11-5-7-12(8-6-11)19-15(14-4-2-10-21-14)18-9-1-3-13(18)16(19)20/h2,4-8,10,13,15H,1,3,9H2/p+1 |
| InChIKey | WOPSRLWVSHTIIW-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 37.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |