C16H18N3OS+ — CID 4647034
3-(3-methylthiophen-2-yl)-2-pyridin-2-yl-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one (PubChem CID 4647034) has the molecular formula C16H18N3OS+ and a molecular weight of 300.41 g/mol. Its IUPAC name is 3-(3-methylthiophen-2-yl)-2-pyridin-2-yl-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one.
| Compound Name | 3-(3-methylthiophen-2-yl)-2-pyridin-2-yl-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one |
|---|---|
| PubChem CID | 4647034 |
| Molecular Formula | C16H18N3OS+ |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-(3-methylthiophen-2-yl)-2-pyridin-2-yl-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one |
| SMILES | Cc1ccsc1C1N(c2ccccn2)C(=O)C2CCC[NH+]21 |
| InChI | InChI=1S/C16H17N3OS/c1-11-7-10-21-14(11)15-18-9-4-5-12(18)16(20)19(15)13-6-2-3-8-17-13/h2-3,6-8,10,12,15H,4-5,9H2,1H3/p+1 |
| InChIKey | UNUOTJGCHZDKGQ-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |