C16H10Cl3NO3S — CID 32990174
(2,4,6-trichlorophenyl) 2-(3-oxo-1,4-benzothiazin-4-yl)acetate (PubChem CID 32990174) has the molecular formula C16H10Cl3NO3S and a molecular weight of 402.69 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 2-(3-oxo-1,4-benzothiazin-4-yl)acetate.
| Compound Name | (2,4,6-trichlorophenyl) 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
|---|---|
| PubChem CID | 32990174 |
| Molecular Formula | C16H10Cl3NO3S |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 400.94 |
| IUPAC Name | (2,4,6-trichlorophenyl) 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl3NO3S/c17-9-5-10(18)16(11(19)6-9)23-15(22)7-20-12-3-1-2-4-13(12)24-8-14(20)21/h1-6H,7-8H2 |
| InChIKey | YSNMXBNGYQWNBV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|