C21H18N2O5S — CID 55379674
3-(1,3-dioxoisoindol-2-yl)propyl 2-(3-oxo-1,4-benzothiazin-4-yl)acetate (PubChem CID 55379674) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 2-(3-oxo-1,4-benzothiazin-4-yl)acetate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
|---|---|
| PubChem CID | 55379674 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H18N2O5S/c24-18-13-29-17-9-4-3-8-16(17)23(18)12-19(25)28-11-5-10-22-20(26)14-6-1-2-7-15(14)21(22)27/h1-4,6-9H,5,10-13H2 |
| InChIKey | OIUDCHGBBFKXQX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|