C21H20FNO4S2 — CID 32998761
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] (3S)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 32998761) has the molecular formula C21H20FNO4S2 and a molecular weight of 433.53 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] (3S)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] (3S)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 32998761 |
| Molecular Formula | C21H20FNO4S2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] (3S)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)[C@H]1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C21H20FNO4S2/c1-26-18-10-13(21-28-8-9-29-21)6-7-17(18)27-20(25)14-11-19(24)23(12-14)16-5-3-2-4-15(16)22/h2-7,10,14,21H,8-9,11-12H2,1H3/t14-/m0/s1 |
| InChIKey | KRBHOFHMJXXGAS-AWEZNQCLSA-N |
| XLogP | 4.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|