C19H20N6O3S2 — CID 3306307
1-[5-morpholin-4-ylsulfonyl-2-(1,2,4-triazol-1-yl)phenyl]-3-phenylthiourea (PubChem CID 3306307) has the molecular formula C19H20N6O3S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[5-morpholin-4-ylsulfonyl-2-(1,2,4-triazol-1-yl)phenyl]-3-phenylthiourea.
| Compound Name | 1-[5-morpholin-4-ylsulfonyl-2-(1,2,4-triazol-1-yl)phenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 3306307 |
| Molecular Formula | C19H20N6O3S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-[5-morpholin-4-ylsulfonyl-2-(1,2,4-triazol-1-yl)phenyl]-3-phenylthiourea |
| SMILES | O=S(=O)(c1ccc(-n2cncn2)c(NC(=S)Nc2ccccc2)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H20N6O3S2/c26-30(27,24-8-10-28-11-9-24)16-6-7-18(25-14-20-13-21-25)17(12-16)23-19(29)22-15-4-2-1-3-5-15/h1-7,12-14H,8-11H2,(H2,22,23,29) |
| InChIKey | XXHQJQAVYCYKJT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|