C21H23Cl2NO3S — CID 3311549
methyl 2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]-5-methyl-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate (PubChem CID 3311549) has the molecular formula C21H23Cl2NO3S and a molecular weight of 440.39 g/mol. Its IUPAC name is methyl 2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]-5-methyl-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]-5-methyl-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3311549 |
| Molecular Formula | C21H23Cl2NO3S |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | methyl 2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]-5-methyl-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C2(C)CC2(Cl)Cl)sc(C)c1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H23Cl2NO3S/c1-11(2)13-6-8-14(9-7-13)15-12(3)28-17(16(15)18(25)27-5)24-19(26)20(4)10-21(20,22)23/h6-9,11H,10H2,1-5H3,(H,24,26) |
| InChIKey | ICSZDTHKFLQSJK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|