C14H20N2O8-2 — CID 3313383
2-[[2-[bis(carboxylatomethyl)azaniumyl]cyclohexyl]-(carboxylatomethyl)azaniumyl]acetate (PubChem CID 3313383) has the molecular formula C14H20N2O8-2 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-[[2-[bis(carboxylatomethyl)azaniumyl]cyclohexyl]-(carboxylatomethyl)azaniumyl]acetate.
| Compound Name | 2-[[2-[bis(carboxylatomethyl)azaniumyl]cyclohexyl]-(carboxylatomethyl)azaniumyl]acetate |
|---|---|
| PubChem CID | 3313383 |
| Molecular Formula | C14H20N2O8-2 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[[2-[bis(carboxylatomethyl)azaniumyl]cyclohexyl]-(carboxylatomethyl)azaniumyl]acetate |
| SMILES | O=C([O-])C[NH+](CC(=O)[O-])C1CCCCC1[NH+](CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C14H22N2O8/c17-11(18)5-15(6-12(19)20)9-3-1-2-4-10(9)16(7-13(21)22)8-14(23)24/h9-10H,1-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)/p-2 |
| InChIKey | FCKYPQBAHLOOJQ-UHFFFAOYSA-L |
| XLogP | -8.93 |
| TPSA | 169.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |