C19H30N4S — CID 3326310
1-(cyclohex-3-en-1-ylmethyl)-3-cyclopentyl-1-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 3326310) has the molecular formula C19H30N4S and a molecular weight of 346.54 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-3-cyclopentyl-1-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-3-cyclopentyl-1-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3326310 |
| Molecular Formula | C19H30N4S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-3-cyclopentyl-1-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | S=C(NC1CCCC1)N(CCCn1ccnc1)CC1CC=CCC1 |
| InChI | InChI=1S/C19H30N4S/c24-19(21-18-9-4-5-10-18)23(15-17-7-2-1-3-8-17)13-6-12-22-14-11-20-16-22/h1-2,11,14,16-18H,3-10,12-13,15H2,(H,21,24) |
| InChIKey | WNNSTIFVXIKFKE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|