C23H31N5O — CID 93240983
5-[[[(1R)-cyclohex-3-en-1-yl]methyl-(3-imidazol-1-ylpropyl)amino]methyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 93240983) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 5-[[[(1R)-cyclohex-3-en-1-yl]methyl-(3-imidazol-1-ylpropyl)amino]methyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[[[(1R)-cyclohex-3-en-1-yl]methyl-(3-imidazol-1-ylpropyl)amino]methyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 93240983 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 5-[[[(1R)-cyclohex-3-en-1-yl]methyl-(3-imidazol-1-ylpropyl)amino]methyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(CN(CCCn3ccnc3)C[C@H]3CC=CCC3)ccc21 |
| InChI | InChI=1S/C23H31N5O/c1-25-21-10-9-20(15-22(21)26(2)23(25)29)17-28(16-19-7-4-3-5-8-19)13-6-12-27-14-11-24-18-27/h3-4,9-11,14-15,18-19H,5-8,12-13,16-17H2,1-2H3/t19-/m0/s1 |
| InChIKey | XSGQSVVNAKDIKY-IBGZPJMESA-N |
| XLogP | 3.32 |
| TPSA | 47.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|