C17H26N4S — CID 4569768
1-(cyclohex-3-en-1-ylmethyl)-3-cyclopropyl-1-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 4569768) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-3-cyclopropyl-1-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-3-cyclopropyl-1-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4569768 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-3-cyclopropyl-1-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | S=C(NC1CC1)N(CCCn1ccnc1)CC1CC=CCC1 |
| InChI | InChI=1S/C17H26N4S/c22-17(19-16-7-8-16)21(13-15-5-2-1-3-6-15)11-4-10-20-12-9-18-14-20/h1-2,9,12,14-16H,3-8,10-11,13H2,(H,19,22) |
| InChIKey | DDAXWKONKSVGQI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|