C21H29N3O — CID 93240979
2-[[[(1R)-cyclohex-3-en-1-yl]methyl-(3-imidazol-1-ylpropyl)amino]methyl]-4-methylphenol (PubChem CID 93240979) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[[[(1R)-cyclohex-3-en-1-yl]methyl-(3-imidazol-1-ylpropyl)amino]methyl]-4-methylphenol.
| Compound Name | 2-[[[(1R)-cyclohex-3-en-1-yl]methyl-(3-imidazol-1-ylpropyl)amino]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 93240979 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 2-[[[(1R)-cyclohex-3-en-1-yl]methyl-(3-imidazol-1-ylpropyl)amino]methyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(CN(CCCn2ccnc2)C[C@H]2CC=CCC2)c1 |
| InChI | InChI=1S/C21H29N3O/c1-18-8-9-21(25)20(14-18)16-24(15-19-6-3-2-4-7-19)12-5-11-23-13-10-22-17-23/h2-3,8-10,13-14,17,19,25H,4-7,11-12,15-16H2,1H3/t19-/m0/s1 |
| InChIKey | NTOKJWFWFNELKB-IBGZPJMESA-N |
| XLogP | 4.15 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|