C20H14ClF2NO — CID 3347125
2-chloro-N-(2,4-difluorophenyl)-2,2-diphenylacetamide (PubChem CID 3347125) has the molecular formula C20H14ClF2NO and a molecular weight of 357.79 g/mol. Its IUPAC name is 2-chloro-N-(2,4-difluorophenyl)-2,2-diphenylacetamide.
| Compound Name | 2-chloro-N-(2,4-difluorophenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3347125 |
| Molecular Formula | C20H14ClF2NO |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-chloro-N-(2,4-difluorophenyl)-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C(Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H14ClF2NO/c21-20(14-7-3-1-4-8-14,15-9-5-2-6-10-15)19(25)24-18-12-11-16(22)13-17(18)23/h1-13H,(H,24,25) |
| InChIKey | ZGJIHALAEQWIGO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|