C17H14Cl2FN3O2S — CID 33482411
2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-6-fluorobenzonitrile (PubChem CID 33482411) has the molecular formula C17H14Cl2FN3O2S and a molecular weight of 414.29 g/mol. Its IUPAC name is 2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-6-fluorobenzonitrile.
| Compound Name | 2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 33482411 |
| Molecular Formula | C17H14Cl2FN3O2S |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)cccc1N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H14Cl2FN3O2S/c18-12-4-5-14(19)17(10-12)26(24,25)23-8-6-22(7-9-23)16-3-1-2-15(20)13(16)11-21/h1-5,10H,6-9H2 |
| InChIKey | MVTYHNFFHKRZBQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |