C25H19Cl2NO3 — CID 3380223
3-benzyl-9-(2,4-dichlorophenyl)-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3380223) has the molecular formula C25H19Cl2NO3 and a molecular weight of 452.34 g/mol. Its IUPAC name is 3-benzyl-9-(2,4-dichlorophenyl)-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 3-benzyl-9-(2,4-dichlorophenyl)-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3380223 |
| Molecular Formula | C25H19Cl2NO3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 3-benzyl-9-(2,4-dichlorophenyl)-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c3c(ccc12)OCN(c1ccc(Cl)cc1Cl)C3 |
| InChI | InChI=1S/C25H19Cl2NO3/c1-15-18-8-10-23-20(13-28(14-30-23)22-9-7-17(26)12-21(22)27)24(18)31-25(29)19(15)11-16-5-3-2-4-6-16/h2-10,12H,11,13-14H2,1H3 |
| InChIKey | MSJMXYAMGFKLKF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|