C26H19ClF3NO3 — CID 3779278
3-benzyl-9-[2-chloro-5-(trifluoromethyl)phenyl]-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3779278) has the molecular formula C26H19ClF3NO3 and a molecular weight of 485.89 g/mol. Its IUPAC name is 3-benzyl-9-[2-chloro-5-(trifluoromethyl)phenyl]-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 3-benzyl-9-[2-chloro-5-(trifluoromethyl)phenyl]-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3779278 |
| Molecular Formula | C26H19ClF3NO3 |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 3-benzyl-9-[2-chloro-5-(trifluoromethyl)phenyl]-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c3c(ccc12)OCN(c1cc(C(F)(F)F)ccc1Cl)C3 |
| InChI | InChI=1S/C26H19ClF3NO3/c1-15-18-8-10-23-20(24(18)34-25(32)19(15)11-16-5-3-2-4-6-16)13-31(14-33-23)22-12-17(26(28,29)30)7-9-21(22)27/h2-10,12H,11,13-14H2,1H3 |
| InChIKey | IYTGSHAZXAVVIR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|