C27H24ClNO3 — CID 3395780
7-benzyl-3-(3-chloro-4-methylphenyl)-6,10-dimethyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one (PubChem CID 3395780) has the molecular formula C27H24ClNO3 and a molecular weight of 445.95 g/mol. Its IUPAC name is 7-benzyl-3-(3-chloro-4-methylphenyl)-6,10-dimethyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one.
| Compound Name | 7-benzyl-3-(3-chloro-4-methylphenyl)-6,10-dimethyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
|---|---|
| PubChem CID | 3395780 |
| Molecular Formula | C27H24ClNO3 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 7-benzyl-3-(3-chloro-4-methylphenyl)-6,10-dimethyl-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
| SMILES | Cc1ccc(N2COc3c(cc4c(C)c(Cc5ccccc5)c(=O)oc4c3C)C2)cc1Cl |
| InChI | InChI=1S/C27H24ClNO3/c1-16-9-10-21(13-24(16)28)29-14-20-12-22-17(2)23(11-19-7-5-4-6-8-19)27(30)32-26(22)18(3)25(20)31-15-29/h4-10,12-13H,11,14-15H2,1-3H3 |
| InChIKey | QTKAQYZQYPVZDC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|