C22H33N4S+ — CID 3387576
2-[(2,6-diethylphenyl)carbamothioyl-(1-pyridin-3-ylethyl)amino]ethyl-dimethylazanium (PubChem CID 3387576) has the molecular formula C22H33N4S+ and a molecular weight of 385.60 g/mol. Its IUPAC name is 2-[(2,6-diethylphenyl)carbamothioyl-(1-pyridin-3-ylethyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(2,6-diethylphenyl)carbamothioyl-(1-pyridin-3-ylethyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 3387576 |
| Molecular Formula | C22H33N4S+ |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-[(2,6-diethylphenyl)carbamothioyl-(1-pyridin-3-ylethyl)amino]ethyl-dimethylazanium |
| SMILES | CCc1cccc(CC)c1NC(=S)N(CC[NH+](C)C)C(C)c1cccnc1 |
| InChI | InChI=1S/C22H32N4S/c1-6-18-10-8-11-19(7-2)21(18)24-22(27)26(15-14-25(4)5)17(3)20-12-9-13-23-16-20/h8-13,16-17H,6-7,14-15H2,1-5H3,(H,24,27)/p+1 |
| InChIKey | HATGTUQRMUTHAP-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 32.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|