C18H24FN4S+ — CID 4217707
2-[(2-fluorophenyl)carbamothioyl-(1-pyridin-2-ylethyl)amino]ethyl-dimethylazanium (PubChem CID 4217707) has the molecular formula C18H24FN4S+ and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)carbamothioyl-(1-pyridin-2-ylethyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(2-fluorophenyl)carbamothioyl-(1-pyridin-2-ylethyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 4217707 |
| Molecular Formula | C18H24FN4S+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[(2-fluorophenyl)carbamothioyl-(1-pyridin-2-ylethyl)amino]ethyl-dimethylazanium |
| SMILES | CC(c1ccccn1)N(CC[NH+](C)C)C(=S)Nc1ccccc1F |
| InChI | InChI=1S/C18H23FN4S/c1-14(16-9-6-7-11-20-16)23(13-12-22(2)3)18(24)21-17-10-5-4-8-15(17)19/h4-11,14H,12-13H2,1-3H3,(H,21,24)/p+1 |
| InChIKey | DMTRGIPSLXDRHX-UHFFFAOYSA-O |
| XLogP | 2.13 |
| TPSA | 32.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|