C21H31N4S+ — CID 3683110
dimethyl-[2-[(4-propan-2-ylphenyl)carbamothioyl-(1-pyridin-3-ylethyl)amino]ethyl]azanium (PubChem CID 3683110) has the molecular formula C21H31N4S+ and a molecular weight of 371.57 g/mol. Its IUPAC name is dimethyl-[2-[(4-propan-2-ylphenyl)carbamothioyl-(1-pyridin-3-ylethyl)amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[(4-propan-2-ylphenyl)carbamothioyl-(1-pyridin-3-ylethyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 3683110 |
| Molecular Formula | C21H31N4S+ |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | dimethyl-[2-[(4-propan-2-ylphenyl)carbamothioyl-(1-pyridin-3-ylethyl)amino]ethyl]azanium |
| SMILES | CC(C)c1ccc(NC(=S)N(CC[NH+](C)C)C(C)c2cccnc2)cc1 |
| InChI | InChI=1S/C21H30N4S/c1-16(2)18-8-10-20(11-9-18)23-21(26)25(14-13-24(4)5)17(3)19-7-6-12-22-15-19/h6-12,15-17H,13-14H2,1-5H3,(H,23,26)/p+1 |
| InChIKey | IDZIWQDDENBGDY-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 32.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|