C25H18Cl2FN3O4S2 — CID 3394950
N'-(benzenesulfonyl)-N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-fluorobenzenecarboximidamide (PubChem CID 3394950) has the molecular formula C25H18Cl2FN3O4S2 and a molecular weight of 578.47 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-fluorobenzenecarboximidamide.
| Compound Name | N'-(benzenesulfonyl)-N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 3394950 |
| Molecular Formula | C25H18Cl2FN3O4S2 |
| Molecular Weight | 578.47 g/mol |
| Exact Mass | 577.01 |
| IUPAC Name | N'-(benzenesulfonyl)-N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-4-fluorobenzenecarboximidamide |
| SMILES | O=S(=O)(N=C(Nc1ccc(Cl)c(S(=O)(=O)Nc2ccccc2Cl)c1)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H18Cl2FN3O4S2/c26-21-8-4-5-9-23(21)30-37(34,35)24-16-19(14-15-22(24)27)29-25(17-10-12-18(28)13-11-17)31-36(32,33)20-6-2-1-3-7-20/h1-16,30H,(H,29,31) |
| InChIKey | FCFDMXGUPXFVOV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|