C19H24NO3+ — CID 3395836
2-(11-hydroxy-2-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,9-pentaen-13-yl)ethyl-dimethylazanium (PubChem CID 3395836) has the molecular formula C19H24NO3+ and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-(11-hydroxy-2-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,9-pentaen-13-yl)ethyl-dimethylazanium.
| Compound Name | 2-(11-hydroxy-2-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,9-pentaen-13-yl)ethyl-dimethylazanium |
|---|---|
| PubChem CID | 3395836 |
| Molecular Formula | C19H24NO3+ |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-(11-hydroxy-2-methoxy-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,9-pentaen-13-yl)ethyl-dimethylazanium |
| SMILES | COc1ccc2c3c1OC1C(O)C=CC(C=C2)C31CC[NH+](C)C |
| InChI | InChI=1S/C19H23NO3/c1-20(2)11-10-19-13-6-4-12-5-9-15(22-3)17(16(12)19)23-18(19)14(21)8-7-13/h4-9,13-14,18,21H,10-11H2,1-3H3/p+1 |
| InChIKey | ZOCTZZQDDXGIRB-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|