C19H21ClO4 — CID 78141310
13'-(2-chloroethyl)-2'-methoxyspiro[1,3-dioxolane-2,11'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6-tetraene] (PubChem CID 78141310) has the molecular formula C19H21ClO4 and a molecular weight of 348.83 g/mol. Its IUPAC name is 13'-(2-chloroethyl)-2'-methoxyspiro[1,3-dioxolane-2,11'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6-tetraene].
| Compound Name | 13'-(2-chloroethyl)-2'-methoxyspiro[1,3-dioxolane-2,11'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6-tetraene] |
|---|---|
| PubChem CID | 78141310 |
| Molecular Formula | C19H21ClO4 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 13'-(2-chloroethyl)-2'-methoxyspiro[1,3-dioxolane-2,11'-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6-tetraene] |
| SMILES | COc1ccc2c3c1OC1C4(CCC(C=C2)C31CCCl)OCCO4 |
| InChI | InChI=1S/C19H21ClO4/c1-21-14-5-3-12-2-4-13-6-7-19(22-10-11-23-19)17-18(13,8-9-20)15(12)16(14)24-17/h2-5,13,17H,6-11H2,1H3 |
| InChIKey | MUDYJHACNYRYGZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|