C18H21NO2 — CID 71546454
(5S,13R)-8-methoxy-16-methyl-6-oxa-16-azapentacyclo[9.5.2.01,13.05,13.07,12]octadeca-7,9,11,17-tetraene (PubChem CID 71546454) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (5S,13R)-8-methoxy-16-methyl-6-oxa-16-azapentacyclo[9.5.2.01,13.05,13.07,12]octadeca-7,9,11,17-tetraene.
| Compound Name | (5S,13R)-8-methoxy-16-methyl-6-oxa-16-azapentacyclo[9.5.2.01,13.05,13.07,12]octadeca-7,9,11,17-tetraene |
|---|---|
| PubChem CID | 71546454 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (5S,13R)-8-methoxy-16-methyl-6-oxa-16-azapentacyclo[9.5.2.01,13.05,13.07,12]octadeca-7,9,11,17-tetraene |
| SMILES | COc1ccc2c3c1O[C@H]1CCCC4(C=C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C18H21NO2/c1-19-11-10-18-14-4-3-8-17(18,19)9-7-12-5-6-13(20-2)16(21-14)15(12)18/h5-7,9,14H,3-4,8,10-11H2,1-2H3/t14-,17?,18+/m0/s1 |
| InChIKey | YPSSROKFUPHWGV-HXFVUSARSA-N |
| XLogP | 2.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |