C17H17NO3 — CID 71546387
(5S,13R)-8-methoxy-6-oxa-16-azapentacyclo[9.5.2.01,13.05,13.07,12]octadeca-7,9,11,17-tetraen-15-one (PubChem CID 71546387) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (5S,13R)-8-methoxy-6-oxa-16-azapentacyclo[9.5.2.01,13.05,13.07,12]octadeca-7,9,11,17-tetraen-15-one.
| Compound Name | (5S,13R)-8-methoxy-6-oxa-16-azapentacyclo[9.5.2.01,13.05,13.07,12]octadeca-7,9,11,17-tetraen-15-one |
|---|---|
| PubChem CID | 71546387 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (5S,13R)-8-methoxy-6-oxa-16-azapentacyclo[9.5.2.01,13.05,13.07,12]octadeca-7,9,11,17-tetraen-15-one |
| SMILES | COc1ccc2c3c1O[C@H]1CCCC4(C=C2)NC(=O)C[C@]314 |
| InChI | InChI=1S/C17H17NO3/c1-20-11-5-4-10-6-8-16-7-2-3-12-17(16,9-13(19)18-16)14(10)15(11)21-12/h4-6,8,12H,2-3,7,9H2,1H3,(H,18,19)/t12-,16?,17+/m0/s1 |
| InChIKey | NPRFWVLFVLANRF-QMEQOSATSA-N |
| XLogP | 2.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |