C19H23NO4 — CID 71658124
2-[(8S,12R,13S)-2-methoxy-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6-tetraen-13-yl]-N,N-dimethylethanamine oxide (PubChem CID 71658124) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[(8S,12R,13S)-2-methoxy-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6-tetraen-13-yl]-N,N-dimethylethanamine oxide.
| Compound Name | 2-[(8S,12R,13S)-2-methoxy-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6-tetraen-13-yl]-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 71658124 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[(8S,12R,13S)-2-methoxy-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6-tetraen-13-yl]-N,N-dimethylethanamine oxide |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@@H](C=C2)[C@@]31CC[N+](C)(C)[O-] |
| InChI | InChI=1S/C19H23NO4/c1-20(2,22)11-10-19-13-6-4-12-5-9-15(23-3)17(16(12)19)24-18(19)14(21)8-7-13/h4-6,9,13,18H,7-8,10-11H2,1-3H3/t13-,18+,19+/m1/s1 |
| InChIKey | QYZVBPURIDYVFX-VMDGZTHMSA-N |
| XLogP | 2.66 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|