C21H29NO5 — CID 139050629
(1R,10S,12S,16S)-3,4,17,17-tetramethoxy-13-methyl-13-azatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5,8-tetraen-16-ol (PubChem CID 139050629) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1R,10S,12S,16S)-3,4,17,17-tetramethoxy-13-methyl-13-azatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5,8-tetraen-16-ol.
| Compound Name | (1R,10S,12S,16S)-3,4,17,17-tetramethoxy-13-methyl-13-azatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5,8-tetraen-16-ol |
|---|---|
| PubChem CID | 139050629 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (1R,10S,12S,16S)-3,4,17,17-tetramethoxy-13-methyl-13-azatetracyclo[10.3.2.01,10.02,7]heptadeca-2(7),3,5,8-tetraen-16-ol |
| SMILES | COc1ccc2c(c1OC)[C@@]13CCN(C)[C@@H](C[C@H]1C=C2)C(OC)(OC)[C@H]3O |
| InChI | InChI=1S/C21H29NO5/c1-22-11-10-20-14(12-16(22)21(26-4,27-5)19(20)23)8-6-13-7-9-15(24-2)18(25-3)17(13)20/h6-9,14,16,19,23H,10-12H2,1-5H3/t14-,16+,19+,20-/m1/s1 |
| InChIKey | ZAIQAQLOESZNGN-MWHZBGGUSA-N |
| XLogP | 2.04 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|