C15H14ClF3N6 — CID 34006271
3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-5,6-dimethylpyridazine-4-carbonitrile (PubChem CID 34006271) has the molecular formula C15H14ClF3N6 and a molecular weight of 370.77 g/mol. Its IUPAC name is 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-5,6-dimethylpyridazine-4-carbonitrile.
| Compound Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-5,6-dimethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 34006271 |
| Molecular Formula | C15H14ClF3N6 |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-5,6-dimethylpyridazine-4-carbonitrile |
| SMILES | Cc1nnc(NCCNc2ncc(C(F)(F)F)cc2Cl)c(C#N)c1C |
| InChI | InChI=1S/C15H14ClF3N6/c1-8-9(2)24-25-13(11(8)6-20)21-3-4-22-14-12(16)5-10(7-23-14)15(17,18)19/h5,7H,3-4H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | OTUKDAIOHNUWTN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|