C12H10N4S2 — CID 3408934
9-prop-2-enyl-8-thiophen-2-yl-3H-purine-6-thione (PubChem CID 3408934) has the molecular formula C12H10N4S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 9-prop-2-enyl-8-thiophen-2-yl-3H-purine-6-thione.
| Compound Name | 9-prop-2-enyl-8-thiophen-2-yl-3H-purine-6-thione |
|---|---|
| PubChem CID | 3408934 |
| Molecular Formula | C12H10N4S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 9-prop-2-enyl-8-thiophen-2-yl-3H-purine-6-thione |
| SMILES | C=CCn1c(-c2cccs2)nc2c(=S)nc[nH]c21 |
| InChI | InChI=1S/C12H10N4S2/c1-2-5-16-10(8-4-3-6-18-8)15-9-11(16)13-7-14-12(9)17/h2-4,6-7H,1,5H2,(H,13,14,17) |
| InChIKey | OORYWSRMULBXTC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|