C20H21N3O4S — CID 34112148
2,3-dioxo-N-(4-phenylcyclohexyl)-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 34112148) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2,3-dioxo-N-(4-phenylcyclohexyl)-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | 2,3-dioxo-N-(4-phenylcyclohexyl)-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 34112148 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2,3-dioxo-N-(4-phenylcyclohexyl)-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)NC3CCC(c4ccccc4)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C20H21N3O4S/c24-19-20(25)22-18-12-16(10-11-17(18)21-19)28(26,27)23-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-5,10-12,14-15,23H,6-9H2,(H,21,24)(H,22,25) |
| InChIKey | SSIMFKKSFSAMND-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|