C19H24N2OS — CID 3414606
phenyl N-(2,2-dimethylpropyl)-N-[(4-hydroxyphenyl)methyl]carbamimidothioate (PubChem CID 3414606) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is phenyl N-(2,2-dimethylpropyl)-N-[(4-hydroxyphenyl)methyl]carbamimidothioate.
| Compound Name | phenyl N-(2,2-dimethylpropyl)-N-[(4-hydroxyphenyl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 3414606 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | phenyl N-(2,2-dimethylpropyl)-N-[(4-hydroxyphenyl)methyl]carbamimidothioate |
| SMILES | [H]/N=C(/Sc1ccccc1)N(Cc1ccc(O)cc1)CC(C)(C)C |
| InChI | InChI=1S/C19H24N2OS/c1-19(2,3)14-21(13-15-9-11-16(22)12-10-15)18(20)23-17-7-5-4-6-8-17/h4-12,20,22H,13-14H2,1-3H3/b20-18+ |
| InChIKey | ZDSNGTINAKVDJY-CZIZESTLSA-N |
| XLogP | 4.97 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|