C22H24N2O2S — CID 3823168
naphthalen-2-yl N-[(4-hydroxyphenyl)methyl]-N-(3-methoxypropyl)carbamimidothioate (PubChem CID 3823168) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is naphthalen-2-yl N-[(4-hydroxyphenyl)methyl]-N-(3-methoxypropyl)carbamimidothioate.
| Compound Name | naphthalen-2-yl N-[(4-hydroxyphenyl)methyl]-N-(3-methoxypropyl)carbamimidothioate |
|---|---|
| PubChem CID | 3823168 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | naphthalen-2-yl N-[(4-hydroxyphenyl)methyl]-N-(3-methoxypropyl)carbamimidothioate |
| SMILES | [H]/N=C(/Sc1ccc2ccccc2c1)N(CCCOC)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-26-14-4-13-24(16-17-7-10-20(25)11-8-17)22(23)27-21-12-9-18-5-2-3-6-19(18)15-21/h2-3,5-12,15,23,25H,4,13-14,16H2,1H3/b23-22+ |
| InChIKey | SXOAXARBMIBBTR-GHVJWSGMSA-N |
| XLogP | 5.11 |
| TPSA | 56.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|