C20H39N3O3S2 — CID 3428060
N-butan-2-yl-8-octylsulfonyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 3428060) has the molecular formula C20H39N3O3S2 and a molecular weight of 433.68 g/mol. Its IUPAC name is N-butan-2-yl-8-octylsulfonyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | N-butan-2-yl-8-octylsulfonyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 3428060 |
| Molecular Formula | C20H39N3O3S2 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-butan-2-yl-8-octylsulfonyl-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | CCCCCCCCS(=O)(=O)N1CCC2(CC1)NC(C(=O)NC(C)CC)CS2 |
| InChI | InChI=1S/C20H39N3O3S2/c1-4-6-7-8-9-10-15-28(25,26)23-13-11-20(12-14-23)22-18(16-27-20)19(24)21-17(3)5-2/h17-18,22H,4-16H2,1-3H3,(H,21,24) |
| InChIKey | YZFFKSLRSJDHBA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|