C19H26N4O4S — CID 7301953
(3S)-N-[(2R)-butan-2-yl]-8-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 7301953) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is (3S)-N-[(2R)-butan-2-yl]-8-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | (3S)-N-[(2R)-butan-2-yl]-8-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 7301953 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (3S)-N-[(2R)-butan-2-yl]-8-(3-nitrobenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)[C@H]1CSC2(CCN(C(=O)c3cccc([N+](=O)[O-])c3)CC2)N1 |
| InChI | InChI=1S/C19H26N4O4S/c1-3-13(2)20-17(24)16-12-28-19(21-16)7-9-22(10-8-19)18(25)14-5-4-6-15(11-14)23(26)27/h4-6,11,13,16,21H,3,7-10,12H2,1-2H3,(H,20,24)/t13-,16-/m1/s1 |
| InChIKey | FPBXEKLMEVLNPA-CZUORRHYSA-N |
| XLogP | 2.15 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|