C24H37N3O2S — CID 7339020
(3S)-N-[(2S)-butan-2-yl]-8-(4-pentylbenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 7339020) has the molecular formula C24H37N3O2S and a molecular weight of 431.65 g/mol. Its IUPAC name is (3S)-N-[(2S)-butan-2-yl]-8-(4-pentylbenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | (3S)-N-[(2S)-butan-2-yl]-8-(4-pentylbenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 7339020 |
| Molecular Formula | C24H37N3O2S |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | (3S)-N-[(2S)-butan-2-yl]-8-(4-pentylbenzoyl)-1-thia-4,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | CCCCCc1ccc(C(=O)N2CCC3(CC2)N[C@@H](C(=O)N[C@@H](C)CC)CS3)cc1 |
| InChI | InChI=1S/C24H37N3O2S/c1-4-6-7-8-19-9-11-20(12-10-19)23(29)27-15-13-24(14-16-27)26-21(17-30-24)22(28)25-18(3)5-2/h9-12,18,21,26H,4-8,13-17H2,1-3H3,(H,25,28)/t18-,21+/m0/s1 |
| InChIKey | GIGSWRKVWYUGGR-GHTZIAJQSA-N |
| XLogP | 3.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|