C27H37N3O2S — CID 3434091
2-(5-hydroxy-4,8a-dimethyl-2-phenyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl)-1-(4-methylpiperazin-1-yl)propan-1-one (PubChem CID 3434091) has the molecular formula C27H37N3O2S and a molecular weight of 467.68 g/mol. Its IUPAC name is 2-(5-hydroxy-4,8a-dimethyl-2-phenyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl)-1-(4-methylpiperazin-1-yl)propan-1-one.
| Compound Name | 2-(5-hydroxy-4,8a-dimethyl-2-phenyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl)-1-(4-methylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 3434091 |
| Molecular Formula | C27H37N3O2S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-(5-hydroxy-4,8a-dimethyl-2-phenyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl)-1-(4-methylpiperazin-1-yl)propan-1-one |
| SMILES | CC(C(=O)N1CCN(C)CC1)C1CCC2(C)Cc3sc(-c4ccccc4)nc3C(C)C2C1O |
| InChI | InChI=1S/C27H37N3O2S/c1-17(26(32)30-14-12-29(4)13-15-30)20-10-11-27(3)16-21-23(18(2)22(27)24(20)31)28-25(33-21)19-8-6-5-7-9-19/h5-9,17-18,20,22,24,31H,10-16H2,1-4H3 |
| InChIKey | BQCYYGLGCFKTRR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |